(R)-4-Phenylthiazolidine-2-thione, 98%
cas: 110199-18-3 — see every product listed under this CAS number, including other names
(R)-4-Phenylthiazolidine-2-thione, 98% (CAS 110199-18-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A943278-250mg |
| cas | 110199-18-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 25g | 2356.19 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 10g | 501.20 Pln | |
| Chemat | 25g | 1024.40 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 636.47 Pln | |
| BLDpharm | 25g | 2535.80 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 435.28 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4R)-4-phenyl-1,3-thiazolidine-2-thione (CAS 110199-18-3) is a chemical compound with the molecular formula C9H9NS2 and a molecular weight of 195.3 g/mol. IUPAC name: (4R)-4-phenyl-1,3-thiazolidine-2-thione. InChIKey: IEXSISKCCADMLK-QMMMGPOBSA-N.
| Molecular formula | C9H9NS2 |
|---|---|
| Molecular weight | 195.3 g/mol |
| IUPAC name | (4R)-4-phenyl-1,3-thiazolidine-2-thione |
| InChIKey | IEXSISKCCADMLK-QMMMGPOBSA-N |
| SMILES | C1[C@H](NC(=S)S1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)