(R)-5-(6-Bromo-3-methyl-2-(piperazin-1-yl)quinoline-4-carboxamido)-4-(2-chlorophenyl)pentanoic acid, 95%
cas: 2772921-54-5 — see every product listed under this CAS number, including other names
(R)-5-(6-Bromo-3-methyl-2-(piperazin-1-yl)quinoline-4-carboxamido)-4-(2-chlorophenyl)pentanoic acid, 95% (CAS 2772921-54-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A12967109-1mg |
| cas | 2772921-54-5 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 498.31 Pln | |
| Ambeed | 5mg | 971.12 Pln | |
| Ambeed | 10mg | 1521.81 Pln | |
| Ambeed | 25mg | 2823.44 Pln | |
| Ambeed | 50mg | 4469.94 Pln | |
| Ambeed | 100mg | 7106.56 Pln | |
| Ambeed | 250mg | 13447.81 Pln | |
| BLDpharm | 1mg | 530.95 Pln | |
| BLDpharm | 5mg | 1041.88 Pln | |
| BLDpharm | 10mg | 1636.12 Pln | |
| BLDpharm | 25mg | 3035.62 Pln | |
| BLDpharm | 50mg | 4818.33 Pln | |
| BLDpharm | 100mg | 7656.22 Pln | |
| BLDpharm | 250mg | 14492.70 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(4R)-5-[(6-bromo-3-methyl-2-piperazin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid (CAS 2772921-54-5) is a chemical compound with the molecular formula C26H28BrClN4O3 and a molecular weight of 559.9 g/mol. IUPAC name: (4R)-5-[(6-bromo-3-methyl-2-piperazin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid. InChIKey: ZZSNHHKTFMLWFY-KRWDZBQOSA-N.
| Molecular formula | C26H28BrClN4O3 |
|---|---|
| Molecular weight | 559.9 g/mol |
| IUPAC name | (4R)-5-[(6-bromo-3-methyl-2-piperazin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid |
| InChIKey | ZZSNHHKTFMLWFY-KRWDZBQOSA-N |
| SMILES | CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCNCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)