(R)-5-(tert-Butyl)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-ium tetrafluoroborate, 97%
cas: 1448816-61-2 — see every product listed under this CAS number, including other names
(R)-5-(tert-Butyl)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-ium tetrafluoroborate, 97% (CAS 1448816-61-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1006164-100mg |
| cas | 1448816-61-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 898.81 Pln | |
| Ambeed | 250mg | 1460.62 Pln | |
| Ambeed | 1g | 3680.06 Pln | |
| Ambeed | 5g | 14510.25 Pln | |
| BLDpharm | 100mg | 964.13 Pln | |
| BLDpharm | 250mg | 1569.47 Pln | |
| BLDpharm | 1g | 3963.07 Pln | |
| BLDpharm | 5g | 15642.29 Pln | |
| Chemat | 100mg | 678.80 Pln | |
| Chemat | 250mg | 1110.80 Pln | |
| Chemat | 1g | 2886.80 Pln | |
| Chemat | 5g | 11354.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(5R)-5-tert-butyl-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate (CAS 1448816-61-2) is a chemical compound with the molecular formula C15H20BF4N3 and a molecular weight of 329.15 g/mol. IUPAC name: (5R)-5-tert-butyl-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate. InChIKey: IDBAAPFMSGHTNG-BTQNPOSSSA-N.
| Molecular formula | C15H20BF4N3 |
|---|---|
| Molecular weight | 329.15 g/mol |
| IUPAC name | (5R)-5-tert-butyl-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate |
| InChIKey | IDBAAPFMSGHTNG-BTQNPOSSSA-N |
| SMILES | [B-](F)(F)(F)F.CC(C)(C)[C@H]1CCC2=NN(C=[N+]12)C3=CC=CC=C3 |
Computed by PubChem (NCBI)