(R)-5-Chloro-2,3-dihydro-1H-inden-1-amine, 95%
cas: 812695-59-3 — see every product listed under this CAS number, including other names
(R)-5-Chloro-2,3-dihydro-1H-inden-1-amine, 95% (CAS 812695-59-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A169523-250mg |
| cas | 812695-59-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 871.00 Pln | |
| Ambeed | 5g | 4058.31 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 842.00 Pln | |
| Chemat | 5g | 3827.60 Pln | |
| Fluorochem | 250mg | 653.95 Pln | |
| Fluorochem | 1g | 1559.89 Pln | |
| Fluorochem | 5g | 6964.23 Pln | |
| BLDpharm | 250mg | 397.66 Pln | |
| BLDpharm | 1g | 930.81 Pln | |
| BLDpharm | 5g | 4374.04 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(1R)-5-chloro-2,3-dihydro-1H-inden-1-amine (CAS 812695-59-3) is a chemical compound with the molecular formula C9H10ClN and a molecular weight of 167.63 g/mol. IUPAC name: (1R)-5-chloro-2,3-dihydro-1H-inden-1-amine. InChIKey: CCNOGOGUHOMLMI-SECBINFHSA-N.
| Molecular formula | C9H10ClN |
|---|---|
| Molecular weight | 167.63 g/mol |
| IUPAC name | (1R)-5-chloro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | CCNOGOGUHOMLMI-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC(=C2)Cl |
Computed by PubChem (NCBI)