(R)-5-Isopropyl-2-mesityl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-ium tetrafluoroborate, 97%
cas: 2216797-99-6 — see every product listed under this CAS number, including other names
(R)-5-Isopropyl-2-mesityl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-ium tetrafluoroborate, 97% (CAS 2216797-99-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1521103-100mg |
| cas | 2216797-99-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 604.00 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 2578.69 Pln | |
| Ambeed | 5g | 10110.31 Pln | |
| BLDpharm | 100mg | 597.59 Pln | |
| BLDpharm | 250mg | 991.90 Pln | |
| BLDpharm | 1g | 2530.24 Pln | |
| BLDpharm | 5g | 9905.43 Pln | |
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 861.20 Pln | |
| Chemat | 1g | 2214.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(5R)-5-propan-2-yl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate (CAS 2216797-99-6) is a chemical compound with the molecular formula C17H24BF4N3 and a molecular weight of 357.2 g/mol. IUPAC name: (5R)-5-propan-2-yl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate. InChIKey: KLUJLVBRAMBYTB-XFULWGLBSA-N.
| Molecular formula | C17H24BF4N3 |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | (5R)-5-propan-2-yl-2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate |
| InChIKey | KLUJLVBRAMBYTB-XFULWGLBSA-N |
| SMILES | [B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)N2C=[N+]3[C@H](CCC3=N2)C(C)C)C |
Computed by PubChem (NCBI)