(R)-5-Isopropyl-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-ium tetrafluoroborate, 97%
cas: 1448816-59-8 — see every product listed under this CAS number, including other names
(R)-5-Isopropyl-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-ium tetrafluoroborate, 97% (CAS 1448816-59-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1521100-100mg |
| cas | 1448816-59-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 759.75 Pln | |
| Ambeed | 250mg | 1282.62 Pln | |
| Ambeed | 1g | 3246.19 Pln | |
| Ambeed | 5g | 12774.75 Pln | |
| Chemat | 100mg | 674.00 Pln | |
| Chemat | 250mg | 1101.20 Pln | |
| Chemat | 1g | 2867.60 Pln | |
| Chemat | 5g | 11277.20 Pln | |
| BLDpharm | 100mg | 747.54 Pln | |
| BLDpharm | 250mg | 1264.02 Pln | |
| BLDpharm | 1g | 3180.02 Pln | |
| BLDpharm | 5g | 12521.17 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(5R)-2-phenyl-5-propan-2-yl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate (CAS 1448816-59-8) is a chemical compound with the molecular formula C14H18BF4N3 and a molecular weight of 315.12 g/mol. IUPAC name: (5R)-2-phenyl-5-propan-2-yl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate. InChIKey: WIYXRGLMHQHWFE-BTQNPOSSSA-N.
| Molecular formula | C14H18BF4N3 |
|---|---|
| Molecular weight | 315.12 g/mol |
| IUPAC name | (5R)-2-phenyl-5-propan-2-yl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate |
| InChIKey | WIYXRGLMHQHWFE-BTQNPOSSSA-N |
| SMILES | [B-](F)(F)(F)F.CC(C)[C@H]1CCC2=NN(C=[N+]12)C3=CC=CC=C3 |
Computed by PubChem (NCBI)