(R)-5-isopropyl-2-(perfluorophenyl)-2,5,6,8-tetrahydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate, 98%
cas: 2254501-59-0 — see every product listed under this CAS number, including other names
(R)-5-isopropyl-2-(perfluorophenyl)-2,5,6,8-tetrahydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate, 98% (CAS 2254501-59-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1340841-250mg |
| cas | 2254501-59-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1138.00 Pln | |
| Ambeed | 1g | 2862.38 Pln | |
| Chemat | 50mg | 496.40 Pln | |
| Chemat | 100mg | 760.40 Pln | |
| Chemat | 250mg | 1178.00 Pln | |
| Chemat | 1g | 2963.60 Pln | |
| BLDpharm | 50mg | 514.29 Pln | |
| BLDpharm | 100mg | 786.41 Pln | |
| BLDpharm | 250mg | 1225.15 Pln | |
| BLDpharm | 1g | 3080.05 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(5R)-2-(2,3,4,5,6-pentafluorophenyl)-5-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate (CAS 2254501-59-0) is a chemical compound with the molecular formula C14H13BF9N3O and a molecular weight of 421.07 g/mol. IUPAC name: (5R)-2-(2,3,4,5,6-pentafluorophenyl)-5-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate. InChIKey: CUTKEDUAINFAJX-FJXQXJEOSA-N.
| Molecular formula | C14H13BF9N3O |
|---|---|
| Molecular weight | 421.07 g/mol |
| IUPAC name | (5R)-2-(2,3,4,5,6-pentafluorophenyl)-5-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate |
| InChIKey | CUTKEDUAINFAJX-FJXQXJEOSA-N |
| SMILES | [B-](F)(F)(F)F.CC(C)[C@@H]1COCC2=NN(C=[N+]12)C3=C(C(=C(C(=C3F)F)F)F)F |
Computed by PubChem (NCBI)