cas: 125572-92-1 — see every product listed under this CAS number, including other names
(R)-6-(Propyl(2-(thiophen-2-yl)ethyl)amino)-5,6,7,8-tetrahydronaphthalen-1-ol hydrochloride, 98% (CAS 125572-92-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609997-50MG |
| cas | 125572-92-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 2158.63 Pln | |
| Fluorochem | 100mg | 3626.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(6R)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol;hydrochloride (CAS 125572-92-1) is a chemical compound with the molecular formula C19H26ClNOS and a molecular weight of 351.9 g/mol. IUPAC name: (6R)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol;hydrochloride. InChIKey: CEXBONHIOKGWNU-PKLMIRHRSA-N.
| Molecular formula | C19H26ClNOS |
|---|---|
| Molecular weight | 351.9 g/mol |
| IUPAC name | (6R)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol;hydrochloride |
| InChIKey | CEXBONHIOKGWNU-PKLMIRHRSA-N |
| SMILES | CCCN(CCC1=CC=CS1)[C@@H]2CCC3=C(C2)C=CC=C3O.Cl |
Computed by PubChem (NCBI)