cas: 888298-05-3 — see every product listed under this CAS number, including other names
(R)-Cbz-3-amino-3-phenylpropan-1-ol (CAS 888298-05-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115C51-1g |
| cas | 888298-05-3 |
| size | 1g |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 179.60 Pln |
| delivery time | 3 weeks |
|---|
Benzyl N-[(1R)-3-hydroxy-1-phenylpropyl]carbamate (CAS 888298-05-3) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: benzyl N-[(1R)-3-hydroxy-1-phenylpropyl]carbamate. InChIKey: LHJCROXNTSGDSP-MRXNPFEDSA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | benzyl N-[(1R)-3-hydroxy-1-phenylpropyl]carbamate |
| InChIKey | LHJCROXNTSGDSP-MRXNPFEDSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)