cas: 133545-16-1 — see every product listed under this CAS number, including other names
(R)-MeO-BIPHEP 98% (CAS 133545-16-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 50mg, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A284492-100g |
| cas | 133545-16-1 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 20350.88 Pln | |
| Ambeed | 50mg | 120.06 Pln | |
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 2239.38 Pln | |
| Ambeed | 25g | 6405.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A284492 |
[2-(2-diphenylphosphanyl-6-methoxyphenyl)-3-methoxyphenyl]-diphenylphosphane (CAS 133545-16-1) is a chemical compound with the molecular formula C38H32O2P2 and a molecular weight of 582.6 g/mol. IUPAC name: [2-(2-diphenylphosphanyl-6-methoxyphenyl)-3-methoxyphenyl]-diphenylphosphane. InChIKey: KRJVQCZJJSUHHO-UHFFFAOYSA-N.
| Molecular formula | C38H32O2P2 |
|---|---|
| Molecular weight | 582.6 g/mol |
| IUPAC name | [2-(2-diphenylphosphanyl-6-methoxyphenyl)-3-methoxyphenyl]-diphenylphosphane |
| InChIKey | KRJVQCZJJSUHHO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)P(C2=CC=CC=C2)C3=CC=CC=C3)C4=C(C=CC=C4P(C5=CC=CC=C5)C6=CC=CC=C6)OC |
Computed by PubChem (NCBI)