cas: 1235639-75-4 — see every product listed under this CAS number, including other names
(R)-Methyl 4-benzyl-5-oxomorpholine-3-carboxylate (CAS 1235639-75-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329347-250MG |
| cas | 1235639-75-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 565.44 Pln | |
| Fluorochem | 5g | 2236.73 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl (3R)-4-benzyl-5-oxomorpholine-3-carboxylate (CAS 1235639-75-4) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: methyl (3R)-4-benzyl-5-oxomorpholine-3-carboxylate. InChIKey: UTUDPLWXJNKTNP-LLVKDONJSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | methyl (3R)-4-benzyl-5-oxomorpholine-3-carboxylate |
| InChIKey | UTUDPLWXJNKTNP-LLVKDONJSA-N |
| SMILES | COC(=O)[C@H]1COCC(=O)N1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)