(R)-N-(3-((2-Aminoethyl)amino)-3-oxopropyl)-2,4-dihydroxy-3,3-dimethylbutanamide, 95%
cas: 943528-71-0 — see every product listed under this CAS number, including other names
(R)-N-(3-((2-Aminoethyl)amino)-3-oxopropyl)-2,4-dihydroxy-3,3-dimethylbutanamide, 95% (CAS 943528-71-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A106008-100mg |
| cas | 943528-71-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2011.31 Pln | |
| Ambeed | 250mg | 3568.81 Pln | |
| Ambeed | 1g | 9504.00 Pln | |
| Chemat | 100mg | 2046.80 Pln | |
| Chemat | 250mg | 3630.80 Pln | |
| Chemat | 1g | 9698.00 Pln | |
| BLDpharm | 100mg | 2163.71 Pln | |
| BLDpharm | 250mg | 3840.89 Pln | |
| BLDpharm | 1g | 10244.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2R)-N-[3-(2-aminoethylamino)-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide (CAS 943528-71-0) is a chemical compound with the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. IUPAC name: (2R)-N-[3-(2-aminoethylamino)-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide. InChIKey: KEMMDXICCGPQBQ-VIFPVBQESA-N.
| Molecular formula | C11H23N3O4 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | (2R)-N-[3-(2-aminoethylamino)-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| InChIKey | KEMMDXICCGPQBQ-VIFPVBQESA-N |
| SMILES | CC(C)(CO)[C@H](C(=O)NCCC(=O)NCCN)O |
Computed by PubChem (NCBI)