cas: 201677-59-0 — see every product listed under this CAS number, including other names
(R)-N-[5-(2-Bromo-1-hydroxyethyl)-2-(phenylmethoxy)phenyl]formamide 95% (CAS 201677-59-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A166720-250mg |
| cas | 201677-59-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 470.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A166720 |
N-[5-[(1R)-2-bromo-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide (CAS 201677-59-0) is a chemical compound with the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. IUPAC name: N-[5-[(1R)-2-bromo-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide. InChIKey: HKSUZIIGCSOMPX-HNNXBMFYSA-N.
| Molecular formula | C16H16BrNO3 |
|---|---|
| Molecular weight | 350.21 g/mol |
| IUPAC name | N-[5-[(1R)-2-bromo-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide |
| InChIKey | HKSUZIIGCSOMPX-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)[C@H](CBr)O)NC=O |
Computed by PubChem (NCBI)