cas: 1212182-03-0 — see every product listed under this CAS number, including other names
(R)-N-BOC-3-(2-HYDROXYETHYL)PYRROLIDINE, 97% (CAS 1212182-03-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468464-100MG |
| cas | 1212182-03-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 846.59 Pln | |
| Fluorochem | 1g | 1903.51 Pln | |
| Fluorochem | 5g | 6360.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3R)-3-(2-hydroxyethyl)pyrrolidine-1-carboxylate (CAS 1212182-03-0) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (3R)-3-(2-hydroxyethyl)pyrrolidine-1-carboxylate. InChIKey: OYRWWTPZWOPIOO-SECBINFHSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (3R)-3-(2-hydroxyethyl)pyrrolidine-1-carboxylate |
| InChIKey | OYRWWTPZWOPIOO-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)CCO |
Computed by PubChem (NCBI)