(R)-SDP, 97%
cas: 917377-74-3 — see every product listed under this CAS number, including other names
(R)-SDP, 97% (CAS 917377-74-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg. Offered by: Ambeed, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A984337-250mg |
| cas | 917377-74-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2795.62 Pln | |
| Ambeed | 1g | 8018.81 Pln | |
| Chemat | 25mg | 400.40 Pln | |
| Chemat | 50mg | 693.20 Pln | |
| Chemat | 100mg | 1038.80 Pln | |
| Chemat | 250mg | 1902.80 Pln | |
| Chemat | 1g | 5085.20 Pln | |
| Fluorochem | 25mg | 305.12 Pln | |
| Fluorochem | 50mg | 539.41 Pln | |
| Fluorochem | 100mg | 981.96 Pln | |
| Fluorochem | 250mg | 2340.86 Pln | |
| Fluorochem | 1g | 8047.18 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(4'-diphenylphosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-yl)-diphenylphosphane (CAS 917377-74-3) is a chemical compound with the molecular formula C41H34P2 and a molecular weight of 588.7 g/mol. IUPAC name: (4'-diphenylphosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-yl)-diphenylphosphane. InChIKey: DKZNVWNOOLQCMJ-UHFFFAOYSA-N.
| Molecular formula | C41H34P2 |
|---|---|
| Molecular weight | 588.7 g/mol |
| IUPAC name | (4'-diphenylphosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-yl)-diphenylphosphane |
| InChIKey | DKZNVWNOOLQCMJ-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC3=C2C(=CC=C3)P(C4=CC=CC=C4)C5=CC=CC=C5)C6=C1C=CC=C6P(C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)
Synonyms:
(S)-SDP, (R)-SDP, (S)-7,7'-bis(diphenylphosphino)-1,1'-spirobiindane((S)-SDP), (S)-7,7'-Bis(diphenylphosphino)-2,2',3,3'-tetrahydro-1,1'-spirobiindane, (R)-(+)-7,7'-Bis(diphenylphosphino)-2,2',3,3'-tetrahydro-1,1'-spirobiindane, (R)-7,7'-Bis(diphenylphosphanyl)-2,2',3,3'-tetrahydro-1,1'-spirobi[indene], (4'-diphenylphosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-yl)-diphenylphosphane, (S)-(-)-7,7'-Bis(diphenylphosphino)-2,2',3,3'-tetrahydro-1,1'-spirobiindane, 7,7'-bis(diphenylphosphaneyl)-2,2',3,3'-tetrahydro-1,1'-spirobi[indene], (R)-SDP,(R)-7,7'-bis(diphenylphosphino)-1,1'-spirobiindane