cas: 454709-96-7 — see every product listed under this CAS number, including other names
(R)-tert-Butyl (2-(methylamino)propyl)carbamate, 95%, 95% (CAS 454709-96-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLFB-100mg |
| cas | 454709-96-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1096.40 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 500mg | 2646.80 Pln | |
| Chemat | 1g | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2R)-2-(methylamino)propyl]carbamate (CAS 454709-96-7) is a chemical compound with the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. IUPAC name: tert-butyl N-[(2R)-2-(methylamino)propyl]carbamate. InChIKey: FIOWXOCWQZXDSB-SSDOTTSWSA-N.
| Molecular formula | C9H20N2O2 |
|---|---|
| Molecular weight | 188.27 g/mol |
| IUPAC name | tert-butyl N-[(2R)-2-(methylamino)propyl]carbamate |
| InChIKey | FIOWXOCWQZXDSB-SSDOTTSWSA-N |
| SMILES | C[C@H](CNC(=O)OC(C)(C)C)NC |
Computed by PubChem (NCBI)