cas: 1311369-01-3 — see every product listed under this CAS number, including other names
(R)-tert-Butyl (3-hydroxybutyl)carbamate, 98% (CAS 1311369-01-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A569120-5g |
| cas | 1311369-01-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 29013.46 Pln | |
| AmBeed | 1g | 8513.47 Pln | |
| Fluorochem | 100mg | 1320.39 Pln | |
| Fluorochem | 250mg | 1950.37 Pln | |
| Fluorochem | 1g | 4793.12 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-[(3R)-3-hydroxybutyl]carbamate (CAS 1311369-01-3) is a chemical compound with the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. IUPAC name: tert-butyl N-[(3R)-3-hydroxybutyl]carbamate. InChIKey: IDXKPWMYURAXTA-SSDOTTSWSA-N.
| Molecular formula | C9H19NO3 |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | tert-butyl N-[(3R)-3-hydroxybutyl]carbamate |
| InChIKey | IDXKPWMYURAXTA-SSDOTTSWSA-N |
| SMILES | C[C@H](CCNC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)