cas: 1189154-01-5 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-(4-bromophenyl)pyrrolidine-1-carboxylate 97% (CAS 1189154-01-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A118865-100mg |
| cas | 1189154-01-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 904.38 Pln | |
| Ambeed | 5g | 3824.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A118865 |
Tert-butyl (2R)-2-(4-bromophenyl)pyrrolidine-1-carboxylate (CAS 1189154-01-5) is a chemical compound with the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. IUPAC name: tert-butyl (2R)-2-(4-bromophenyl)pyrrolidine-1-carboxylate. InChIKey: PZDPUQUIZKCNOF-CYBMUJFWSA-N.
| Molecular formula | C15H20BrNO2 |
|---|---|
| Molecular weight | 326.23 g/mol |
| IUPAC name | tert-butyl (2R)-2-(4-bromophenyl)pyrrolidine-1-carboxylate |
| InChIKey | PZDPUQUIZKCNOF-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)