cas: 887626-82-6 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-(aminomethyl)azetidine-1-carboxylate, 98% (CAS 887626-82-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F445839-100MG |
| cas | 887626-82-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 638.33 Pln | |
| Fluorochem | 250mg | 981.96 Pln | |
| Fluorochem | 500mg | 1539.06 Pln | |
| Fluorochem | 1g | 2163.84 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2R)-2-(aminomethyl)azetidine-1-carboxylate (CAS 887626-82-6) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. IUPAC name: tert-butyl (2R)-2-(aminomethyl)azetidine-1-carboxylate. InChIKey: XTIGSUFOTRCYOO-SSDOTTSWSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | tert-butyl (2R)-2-(aminomethyl)azetidine-1-carboxylate |
| InChIKey | XTIGSUFOTRCYOO-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]1CN |
Computed by PubChem (NCBI)