cas: 119838-44-7 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-(tert-butyl)-3-methyl-4-oxoimidazolidine-1-carboxylate 95+% (CAS 119838-44-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A597246-50mg |
| cas | 119838-44-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 481.62 Pln | |
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1577.44 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A597246 |
Tert-butyl (2R)-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate (CAS 119838-44-7) is a chemical compound with the molecular formula C13H24N2O3 and a molecular weight of 256.34 g/mol. IUPAC name: tert-butyl (2R)-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate. InChIKey: HJJLVATZPPJBNG-SNVBAGLBSA-N.
| Molecular formula | C13H24N2O3 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | tert-butyl (2R)-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate |
| InChIKey | HJJLVATZPPJBNG-SNVBAGLBSA-N |
| SMILES | CC(C)(C)[C@@H]1N(C(=O)CN1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)