(R)-tert-Butyl pyrrolidine-3-carboxylate, 95%
cas: 681288-45-9 — see every product listed under this CAS number, including other names
(R)-tert-Butyl pyrrolidine-3-carboxylate, 95% (CAS 681288-45-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A385673-100mg |
| cas | 681288-45-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 503.88 Pln | |
| Ambeed | 1g | 1471.75 Pln | |
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 500mg | 842.00 Pln | |
| Chemat | 1g | 1360.40 Pln | |
| Chemat | 5g | 3962.00 Pln | |
| Chemat | 10g | 6558.80 Pln | |
| Chemat | 25g | 13058.00 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 536.50 Pln | |
| BLDpharm | 1g | 1580.58 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl (3R)-pyrrolidine-3-carboxylate (CAS 681288-45-9) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: tert-butyl (3R)-pyrrolidine-3-carboxylate. InChIKey: XWAHLXHVEMYNMY-SSDOTTSWSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | tert-butyl (3R)-pyrrolidine-3-carboxylate |
| InChIKey | XWAHLXHVEMYNMY-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCNC1 |
Computed by PubChem (NCBI)