cas: 192214-00-9 — see every product listed under this CAS number, including other names
(S)–1–((Benzyloxy)carbonyl)pyrrolidine–3–carboxylic acid (CAS 192214-00-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF49504-10g |
| cas | 192214-00-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 1584.63 Pln | |
| GLPBio | 1g | 657.89 Pln | |
| GLPBio | 250mg | 517.47 Pln | |
| GLPBio | 5g | 1139.98 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S)-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 192214-00-9) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: (3S)-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: JSASVUTVTRNJHA-NSHDSACASA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | (3S)-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | JSASVUTVTRNJHA-NSHDSACASA-N |
| SMILES | C1CN(C[C@H]1C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)