cas: 39570-63-3 — see every product listed under this CAS number, including other names
(S)-(-)-2-isocyanato-4-methylvalericacidmethylester, 98%, 98% (CAS 39570-63-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CDP-1g |
| cas | 39570-63-3 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 818.00 Pln | |
| Chemat | 25g | 2402.00 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 10g | 1230.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-isocyanato-4-methylpentanoate (CAS 39570-63-3) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: methyl (2S)-2-isocyanato-4-methylpentanoate. InChIKey: UWFLIWPVRTVDNO-ZETCQYMHSA-N.
| Molecular formula | C8H13NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | methyl (2S)-2-isocyanato-4-methylpentanoate |
| InChIKey | UWFLIWPVRTVDNO-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)N=C=O |
Computed by PubChem (NCBI)