cas: 1415380-62-9 — see every product listed under this CAS number, including other names
(S)-1-(2,3-Difluorophenyl)ethanamine, 97%, 97% (CAS 1415380-62-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110G42-100mg |
| cas | 1415380-62-9 |
| size | 100mg |
| availability | 14g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 784.40 Pln | |
| Chemat | 250mg | 1250.00 Pln | |
| Chemat | 1g | 3045.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-(2,3-difluorophenyl)ethanamine (CAS 1415380-62-9) is a chemical compound with the molecular formula C8H9F2N and a molecular weight of 157.16 g/mol. IUPAC name: (1S)-1-(2,3-difluorophenyl)ethanamine. InChIKey: KETZXWRRCDXDFT-YFKPBYRVSA-N.
| Molecular formula | C8H9F2N |
|---|---|
| Molecular weight | 157.16 g/mol |
| IUPAC name | (1S)-1-(2,3-difluorophenyl)ethanamine |
| InChIKey | KETZXWRRCDXDFT-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C(=CC=C1)F)F)N |
Computed by PubChem (NCBI)