cas: 845252-02-0 — see every product listed under this CAS number, including other names
(S)-1-(2,4-Difluorophenyl)ethanamine, 97% (CAS 845252-02-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209214-250MG |
| cas | 845252-02-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 378.01 Pln | |
| Fluorochem | 5g | 1658.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-1-(2,4-difluorophenyl)ethanamine (CAS 845252-02-0) is a chemical compound with the molecular formula C8H9F2N and a molecular weight of 157.16 g/mol. IUPAC name: (1S)-1-(2,4-difluorophenyl)ethanamine. InChIKey: VBPKWFKAYDHOQW-YFKPBYRVSA-N.
| Molecular formula | C8H9F2N |
|---|---|
| Molecular weight | 157.16 g/mol |
| IUPAC name | (1S)-1-(2,4-difluorophenyl)ethanamine |
| InChIKey | VBPKWFKAYDHOQW-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)F)F)N |
Computed by PubChem (NCBI)