cas: 755025-16-2 — see every product listed under this CAS number, including other names
(S)-1-(2,4-Dimethoxybenzyl)-5-oxopyrrolidine-3-carboxylic acid, 97% (CAS 755025-16-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A688543-100mg |
| cas | 755025-16-2 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 460.60 Pln | |
| AmBeed | 10g | 7608.58 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 755025-16-2) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: (3S)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: OZFGRQLUQFPWPR-JTQLQIEISA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (3S)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | OZFGRQLUQFPWPR-JTQLQIEISA-N |
| SMILES | COC1=CC(=C(C=C1)CN2C[C@H](CC2=O)C(=O)O)OC |
Computed by PubChem (NCBI)