cas: 321318-17-6 — see every product listed under this CAS number, including other names
(S)-1-(3,4-Difluorophenyl)ethanamine 95% (CAS 321318-17-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A567573-100mg |
| cas | 321318-17-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 676.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A567573 |
(1S)-1-(3,4-difluorophenyl)ethanamine (CAS 321318-17-6) is a chemical compound with the molecular formula C8H9F2N and a molecular weight of 157.16 g/mol. IUPAC name: (1S)-1-(3,4-difluorophenyl)ethanamine. InChIKey: AESHLRAPTJZOJL-YFKPBYRVSA-N.
| Molecular formula | C8H9F2N |
|---|---|
| Molecular weight | 157.16 g/mol |
| IUPAC name | (1S)-1-(3,4-difluorophenyl)ethanamine |
| InChIKey | AESHLRAPTJZOJL-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)F)F)N |
Computed by PubChem (NCBI)