(S)-1-(3-(Methylthio)phenyl)ethan-1-ol, 95%
cas: 666743-54-0 — see every product listed under this CAS number, including other names
(S)-1-(3-(Methylthio)phenyl)ethan-1-ol, 95% (CAS 666743-54-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2978688-50mg |
| cas | 666743-54-0 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 414.88 Pln | |
| Ambeed | 100mg | 654.06 Pln | |
| Ambeed | 250mg | 1104.63 Pln | |
| Ambeed | 1g | 2867.94 Pln | |
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1048.40 Pln | |
| Chemat | 1g | 2723.60 Pln | |
| BLDpharm | 50mg | 442.09 Pln | |
| BLDpharm | 100mg | 697.56 Pln | |
| BLDpharm | 250mg | 1186.27 Pln | |
| BLDpharm | 1g | 3085.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(1S)-1-(3-methylsulfanylphenyl)ethanol (CAS 666743-54-0) is a chemical compound with the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. IUPAC name: (1S)-1-(3-methylsulfanylphenyl)ethanol. InChIKey: YXMYZYXSEIMZQD-ZETCQYMHSA-N.
| Molecular formula | C9H12OS |
|---|---|
| Molecular weight | 168.26 g/mol |
| IUPAC name | (1S)-1-(3-methylsulfanylphenyl)ethanol |
| InChIKey | YXMYZYXSEIMZQD-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)SC)O |
Computed by PubChem (NCBI)