cas: 139305-96-7 — see every product listed under this CAS number, including other names
(S)-1-(3-Bromophenyl)ethanamine 98% (CAS 139305-96-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A554454-100mg |
| cas | 139305-96-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 10g | 726.38 Pln | |
| Ambeed | 25g | 1377.19 Pln | |
| Ambeed | 100g | 4258.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A554454 |
(1S)-1-(3-bromophenyl)ethanamine (CAS 139305-96-7) is a chemical compound with the molecular formula C8H10BrN and a molecular weight of 200.08 g/mol. IUPAC name: (1S)-1-(3-bromophenyl)ethanamine. InChIKey: LIBZHYLTOAGURM-LURJTMIESA-N.
| Molecular formula | C8H10BrN |
|---|---|
| Molecular weight | 200.08 g/mol |
| IUPAC name | (1S)-1-(3-bromophenyl)ethanamine |
| InChIKey | LIBZHYLTOAGURM-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)Br)N |
Computed by PubChem (NCBI)