cas: 56782-68-4 — see every product listed under this CAS number, including other names
(S)-1-(4-Chlorophenyl)ethanamine hydrochloride 98% (CAS 56782-68-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1473823-250mg |
| cas | 56782-68-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 159.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1473823 |
(1S)-1-(4-chlorophenyl)ethanamine;hydrochloride (CAS 56782-68-4) is a chemical compound with the molecular formula C8H11Cl2N and a molecular weight of 192.08 g/mol. IUPAC name: (1S)-1-(4-chlorophenyl)ethanamine;hydrochloride. InChIKey: BADVPOKOZMYLPI-RGMNGODLSA-N.
| Molecular formula | C8H11Cl2N |
|---|---|
| Molecular weight | 192.08 g/mol |
| IUPAC name | (1S)-1-(4-chlorophenyl)ethanamine;hydrochloride |
| InChIKey | BADVPOKOZMYLPI-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)