cas: 41851-59-6 — see every product listed under this CAS number, including other names
(S)-1-(4-Methoxy-phenyl)-ethylamine, 98% (CAS 41851-59-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040169-5G |
| cas | 41851-59-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 315.53 Pln | |
| Fluorochem | 100g | 903.87 Pln | |
| Fluorochem | 500g | 3533.15 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(1S)-1-(4-methoxyphenyl)ethanamine (CAS 41851-59-6) is a chemical compound with the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. IUPAC name: (1S)-1-(4-methoxyphenyl)ethanamine. InChIKey: JTDGKQNNPKXKII-ZETCQYMHSA-N.
| Molecular formula | C9H13NO |
|---|---|
| Molecular weight | 151.21 g/mol |
| IUPAC name | (1S)-1-(4-methoxyphenyl)ethanamine |
| InChIKey | JTDGKQNNPKXKII-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)OC)N |
Computed by PubChem (NCBI)