(S)-1-(5-Bromothiophen-2-yl)-2-fluoroethan-1-amine, 95%
cas: 1932248-59-3 — see every product listed under this CAS number, including other names
(S)-1-(5-Bromothiophen-2-yl)-2-fluoroethan-1-amine, 95% (CAS 1932248-59-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A14444071-100mg |
| cas | 1932248-59-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 787.56 Pln | |
| Ambeed | 250mg | 1360.50 Pln | |
| Ambeed | 1g | 3424.19 Pln | |
| Ambeed | 5g | 11122.69 Pln | |
| Ambeed | 10g | 18860.12 Pln | |
| Ambeed | 25g | 37650.25 Pln | |
| BLDpharm | 100mg | 847.50 Pln | |
| BLDpharm | 250mg | 1463.95 Pln | |
| BLDpharm | 1g | 3685.39 Pln | |
| BLDpharm | 5g | 11988.03 Pln | |
| BLDpharm | 10g | 20329.53 Pln | |
| BLDpharm | 25g | 40594.62 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(1S)-1-(5-bromothiophen-2-yl)-2-fluoroethanamine (CAS 1932248-59-3) is a chemical compound with the molecular formula C6H7BrFNS and a molecular weight of 224.10 g/mol. IUPAC name: (1S)-1-(5-bromothiophen-2-yl)-2-fluoroethanamine. InChIKey: RNFMBIJJTXEBLE-BYPYZUCNSA-N.
| Molecular formula | C6H7BrFNS |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | (1S)-1-(5-bromothiophen-2-yl)-2-fluoroethanamine |
| InChIKey | RNFMBIJJTXEBLE-BYPYZUCNSA-N |
| SMILES | C1=C(SC(=C1)Br)[C@H](CF)N |
Computed by PubChem (NCBI)