cas: 203866-15-3 — see every product listed under this CAS number, including other names
(S)-1-(tert-Butoxycarbonyl)-4,4-difluoropyrrolidine-2-carboxylic acid, 98%, 98% (CAS 203866-15-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11306P-250mg |
| cas | 203866-15-3 |
| size | 250mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 299.60 Pln | |
| Chemat | 50g | 534.80 Pln | |
| Chemat | 100g | 1005.20 Pln | |
| Chemat | 250g | 2416.40 Pln | |
| Chemat | 500g | 3667.20 Pln | |
| Chemat | 1kg | 5339.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 203866-15-3) is a chemical compound with the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. IUPAC name: (2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: WTMZYKCXBXPVPT-LURJTMIESA-N.
| Molecular formula | C10H15F2NO4 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WTMZYKCXBXPVPT-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@H]1C(=O)O)(F)F |
Computed by PubChem (NCBI)