cas: 168466-85-1 — see every product listed under this CAS number, including other names
(S)-1-Benzylpiperidin-3-amine 96% (CAS 168466-85-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1370638-1g |
| cas | 168466-85-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1037.88 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1370638 |
(3S)-1-benzylpiperidin-3-amine (CAS 168466-85-1) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 190.28 g/mol. IUPAC name: (3S)-1-benzylpiperidin-3-amine. InChIKey: HARWNWOLWMTQCC-LBPRGKRZSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | (3S)-1-benzylpiperidin-3-amine |
| InChIKey | HARWNWOLWMTQCC-LBPRGKRZSA-N |
| SMILES | C1C[C@@H](CN(C1)CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)