cas: 199174-24-8 — see every product listed under this CAS number, including other names
(S)-1-Boc-(3-Hydroxymethyl)pyrrolidine, 98%, 98% (CAS 199174-24-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CJR-250mg |
| cas | 199174-24-8 |
| size | 250mg |
| availability | 174.97g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 318.80 Pln | |
| Chemat | 25g | 683.60 Pln | |
| Chemat | 50g | 1288.40 Pln | |
| Chemat | 100g | 2474.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S)-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 199174-24-8) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl (3S)-3-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: HKIGXXRMJFUUKV-QMMMGPOBSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl (3S)-3-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | HKIGXXRMJFUUKV-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)CO |
Computed by PubChem (NCBI)