cas: 119020-01-8 — see every product listed under this CAS number, including other names
(S)-1-Boc-2-(aminomethyl)pyrrolidine, 99.95% (CAS 119020-01-8) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-40102-5 g |
| cas | 119020-01-8 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 263.96 Pln | |
| MedChemExpress | 10 g | 361.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.95% |
Tert-butyl (2S)-2-(aminomethyl)pyrrolidine-1-carboxylate (CAS 119020-01-8) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl (2S)-2-(aminomethyl)pyrrolidine-1-carboxylate. InChIKey: SOGXYCNKQQJEED-QMMMGPOBSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl (2S)-2-(aminomethyl)pyrrolidine-1-carboxylate |
| InChIKey | SOGXYCNKQQJEED-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CN |
Computed by PubChem (NCBI)