cas: 475272-54-9 — see every product listed under this CAS number, including other names
(S)-1-Boc-3-Isopropylpiperazine, 98% (CAS 475272-54-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211346-250MG |
| cas | 475272-54-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 10g | 2111.77 Pln | |
| Fluorochem | 25g | 4610.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-3-propan-2-ylpiperazine-1-carboxylate (CAS 475272-54-9) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl (3S)-3-propan-2-ylpiperazine-1-carboxylate. InChIKey: UHLAQCKNCBYTIF-SNVBAGLBSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl (3S)-3-propan-2-ylpiperazine-1-carboxylate |
| InChIKey | UHLAQCKNCBYTIF-SNVBAGLBSA-N |
| SMILES | CC(C)[C@H]1CN(CCN1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)