(S)-2,2'-Bis((R)-4-(tert-butyl)-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, 97%
cas: 155418-83-0 — see every product listed under this CAS number, including other names
(S)-2,2'-Bis((R)-4-(tert-butyl)-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, 97% (CAS 155418-83-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1519830-250mg |
| cas | 155418-83-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 898.81 Pln | |
| Ambeed | 1g | 2306.13 Pln | |
| Ambeed | 5g | 9025.62 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 880.83 Pln | |
| BLDpharm | 1g | 2269.23 Pln | |
| BLDpharm | 5g | 8844.69 Pln | |
| Chemat | 100mg | 496.40 Pln | |
| Chemat | 250mg | 803.60 Pln | |
| Chemat | 1g | 2061.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4R)-4-tert-butyl-2-[1-[2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-dihydro-1,3-oxazole (CAS 155418-83-0) is a chemical compound with the molecular formula C34H36N2O2 and a molecular weight of 504.7 g/mol. IUPAC name: (4R)-4-tert-butyl-2-[1-[2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-dihydro-1,3-oxazole. InChIKey: OUZYYVUZHWKREV-NSOVKSMOSA-N.
| Molecular formula | C34H36N2O2 |
|---|---|
| Molecular weight | 504.7 g/mol |
| IUPAC name | (4R)-4-tert-butyl-2-[1-[2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-dihydro-1,3-oxazole |
| InChIKey | OUZYYVUZHWKREV-NSOVKSMOSA-N |
| SMILES | CC(C)(C)[C@@H]1COC(=N1)C2=C(C3=CC=CC=C3C=C2)C4=C(C=CC5=CC=CC=C54)C6=N[C@@H](CO6)C(C)(C)C |
Computed by PubChem (NCBI)