(S)-2,2'-Bis((S)-4-isopropyl-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, 97%
cas: 155343-02-5 — see every product listed under this CAS number, including other names
(S)-2,2'-Bis((S)-4-isopropyl-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, 97% (CAS 155343-02-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1519825-100mg |
| cas | 155343-02-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 659.62 Pln | |
| Ambeed | 250mg | 1071.25 Pln | |
| Ambeed | 1g | 2773.38 Pln | |
| Ambeed | 5g | 10889.06 Pln | |
| BLDpharm | 100mg | 703.11 Pln | |
| BLDpharm | 250mg | 1147.40 Pln | |
| BLDpharm | 1g | 2985.64 Pln | |
| BLDpharm | 5g | 11738.11 Pln | |
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 1038.80 Pln | |
| Chemat | 1g | 2699.60 Pln | |
| Chemat | 5g | 10610.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(4S)-4-propan-2-yl-2-[1-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-dihydro-1,3-oxazole (CAS 155343-02-5) is a chemical compound with the molecular formula C32H32N2O2 and a molecular weight of 476.6 g/mol. IUPAC name: (4S)-4-propan-2-yl-2-[1-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-dihydro-1,3-oxazole. InChIKey: GSYYZBATXJFEKJ-VSGBNLITSA-N.
| Molecular formula | C32H32N2O2 |
|---|---|
| Molecular weight | 476.6 g/mol |
| IUPAC name | (4S)-4-propan-2-yl-2-[1-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-dihydro-1,3-oxazole |
| InChIKey | GSYYZBATXJFEKJ-VSGBNLITSA-N |
| SMILES | CC(C)[C@H]1COC(=N1)C2=C(C3=CC=CC=C3C=C2)C4=C(C=CC5=CC=CC=C54)C6=N[C@H](CO6)C(C)C |
Computed by PubChem (NCBI)