CAS 70371-56-1 appears in our catalog under these names: (S)-2,6-Dimethyl-N-(pyrrolidin-2-ylmethyl)aniline, 97%, 97%, (S)-2,6-Dimethyl-N-(pyrrolidin-2-ylmethyl)aniline, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,6-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]aniline (CAS 70371-56-1) is a chemical compound with the molecular formula C13H20N2 and a molecular weight of 204.31 g/mol. IUPAC name: 2,6-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]aniline. InChIKey: UWCWUCKPEYNDNV-LBPRGKRZSA-N.
| Molecular formula | C13H20N2 |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 2,6-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]aniline |
| InChIKey | UWCWUCKPEYNDNV-LBPRGKRZSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC[C@@H]2CCCN2 |
Computed by PubChem (NCBI)