cas: 1217716-50-1 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-3-(4-chlorophenyl)propanoic acid, 97% (CAS 1217716-50-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633975-100MG |
| cas | 1217716-50-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 10g | 1216.26 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-(4-chlorophenyl)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid (CAS 1217716-50-1) is a chemical compound with the molecular formula C25H22ClNO4 and a molecular weight of 435.9 g/mol. IUPAC name: (2S)-3-(4-chlorophenyl)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid. InChIKey: DTVJLZWXYPPOHJ-QHCPKHFHSA-N.
| Molecular formula | C25H22ClNO4 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | (2S)-3-(4-chlorophenyl)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid |
| InChIKey | DTVJLZWXYPPOHJ-QHCPKHFHSA-N |
| SMILES | CN([C@@H](CC1=CC=C(C=C1)Cl)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)