cas: 204058-25-3 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-(tert-butoxycarbonyl)piperidin-4-yl)propanoic acid, 98%, 98% (CAS 204058-25-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11300J-100mg |
| cas | 204058-25-3 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2819.60 Pln | |
| Chemat | 50g | 4470.80 Pln | |
| Chemat | 100g | 5589.20 Pln | |
| Chemat | 250g | 11426.00 Pln | |
| Chemat | 500g | 22646.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propanoic acid (CAS 204058-25-3) is a chemical compound with the molecular formula C28H34N2O6 and a molecular weight of 494.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propanoic acid. InChIKey: JVDSTYGNXVJVKL-DEOSSOPVSA-N.
| Molecular formula | C28H34N2O6 |
|---|---|
| Molecular weight | 494.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]propanoic acid |
| InChIKey | JVDSTYGNXVJVKL-DEOSSOPVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)