cas: 823780-66-1 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-((bis(methylamino)methylene)amino)pentanoic acid, 98% (CAS 823780-66-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F616702-100MG |
| cas | 823780-66-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1080.89 Pln | |
| Fluorochem | 5g | 4631.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-5-[(N,N'-dimethylcarbamimidoyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 823780-66-1) is a chemical compound with the molecular formula C23H28N4O4 and a molecular weight of 424.5 g/mol. IUPAC name: (2S)-5-[(N,N'-dimethylcarbamimidoyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: DQWCPMLQUQTZMJ-FQEVSTJZSA-N.
| Molecular formula | C23H28N4O4 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | (2S)-5-[(N,N'-dimethylcarbamimidoyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | DQWCPMLQUQTZMJ-FQEVSTJZSA-N |
| SMILES | CNC(=NC)NCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)