cas: 159751-46-9 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-7-(tert-butoxy)-7-oxoheptanoic acid, 96% (CAS 159751-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F616754-100MG |
| cas | 159751-46-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 596.68 Pln | |
| Fluorochem | 250mg | 768.50 Pln | |
| Fluorochem | 1g | 1325.59 Pln | |
| Fluorochem | 5g | 3902.81 Pln | |
| Fluorochem | 25g | 12774.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid (CAS 159751-46-9) is a chemical compound with the molecular formula C26H31NO6 and a molecular weight of 453.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid. InChIKey: IAWSYDYLILBRJM-QFIPXVFZSA-N.
| Molecular formula | C26H31NO6 |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid |
| InChIKey | IAWSYDYLILBRJM-QFIPXVFZSA-N |
| SMILES | CC(C)(C)OC(=O)CCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)