(S)-2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine (2R,3R)-2,3-dihydroxysuccinate, 97%
cas: 210095-58-2 — see every product listed under this CAS number, including other names
(S)-2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine (2R,3R)-2,3-dihydroxysuccinate, 97% (CAS 210095-58-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A108302-1g |
| cas | 210095-58-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 453.81 Pln | |
| Ambeed | 25g | 843.19 Pln | |
| Ambeed | 100g | 2539.75 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 414.80 Pln | |
| Chemat | 10g | 630.80 Pln | |
| Chemat | 25g | 1144.40 Pln | |
| BLDpharm | 1g | 142.20 Pln | |
| BLDpharm | 5g | 308.80 Pln | |
| BLDpharm | 10g | 486.52 Pln | |
| BLDpharm | 25g | 903.04 Pln | |
| BLDpharm | 100g | 2735.73 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 210095-58-2) is a chemical compound with the molecular formula C21H25ClN2O7 and a molecular weight of 452.9 g/mol. IUPAC name: 2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: MLVGFEZTZHIUGZ-YRSVLNEHSA-N.
| Molecular formula | C21H25ClN2O7 |
|---|---|
| Molecular weight | 452.9 g/mol |
| IUPAC name | 2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | MLVGFEZTZHIUGZ-YRSVLNEHSA-N |
| SMILES | C1CNCCC1O[C@@H](C2=CC=C(C=C2)Cl)C3=CC=CC=N3.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)