cas: 84889-09-8 — see every product listed under this CAS number, including other names
(S)-2-((S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-phenylpropanamido)-3-phenylpropanoic acid, 97% (CAS 84889-09-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F869213-1G |
| cas | 84889-09-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 596.68 Pln | |
| Fluorochem | 100g | 2221.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (CAS 84889-09-8) is a chemical compound with the molecular formula C33H30N2O5 and a molecular weight of 534.6 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoic acid. InChIKey: KZPTXQVSHOISSL-KYJUHHDHSA-N.
| Molecular formula | C33H30N2O5 |
|---|---|
| Molecular weight | 534.6 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | KZPTXQVSHOISSL-KYJUHHDHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)