(S)-2-(2-(Bis(4-(trifluoromethyl)phenyl)phosphino)-5-(trifluoromethyl)phenyl)-4-(tert-butyl)-4,5-dihydrooxazole, 97%
cas: 944836-22-0 — see every product listed under this CAS number, including other names
(S)-2-(2-(Bis(4-(trifluoromethyl)phenyl)phosphino)-5-(trifluoromethyl)phenyl)-4-(tert-butyl)-4,5-dihydrooxazole, 97% (CAS 944836-22-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1219993-100mg |
| cas | 944836-22-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 754.19 Pln | |
| Ambeed | 250mg | 1393.88 Pln | |
| Ambeed | 1g | 4525.56 Pln | |
| Fluorochem | 5g | 15742.39 Pln | |
| BLDpharm | 50mg | 464.31 Pln | |
| BLDpharm | 100mg | 808.63 Pln | |
| BLDpharm | 250mg | 1497.28 Pln | |
| BLDpharm | 1g | 4873.86 Pln | |
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 929.90 Pln | |
| Fluorochem | 1g | 3340.51 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane (CAS 944836-22-0) is a chemical compound with the molecular formula C28H23F9NOP and a molecular weight of 591.4 g/mol. IUPAC name: [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane. InChIKey: FIQFFQBQQIDYQG-HSZRJFAPSA-N.
| Molecular formula | C28H23F9NOP |
|---|---|
| Molecular weight | 591.4 g/mol |
| IUPAC name | [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane |
| InChIKey | FIQFFQBQQIDYQG-HSZRJFAPSA-N |
| SMILES | CC(C)(C)[C@H]1COC(=N1)C2=C(C=CC(=C2)C(F)(F)F)P(C3=CC=C(C=C3)C(F)(F)F)C4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
(S)-(CF3)3-t-Bu-PHOX, FIQFFQBQQIDYQG-HSZRJFAPSA-N