(S)-2-(2-Isopropylphenyl)pyrrolidine, 95%
cas: 1212895-72-1 — see every product listed under this CAS number, including other names
(S)-2-(2-Isopropylphenyl)pyrrolidine, 95% (CAS 1212895-72-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1353816-100mg |
| cas | 1212895-72-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1332.69 Pln | |
| Ambeed | 250mg | 1638.62 Pln | |
| Ambeed | 1g | 1955.69 Pln | |
| Ambeed | 5g | 6261.06 Pln | |
| Chemat | 100mg | 520.40 Pln | |
| Chemat | 250mg | 712.40 Pln | |
| Chemat | 500mg | 1178.00 Pln | |
| Chemat | 1g | 1547.60 Pln | |
| Chemat | 5g | 5075.60 Pln | |
| Chemat | 10g | 9251.60 Pln | |
| Chemat | 25g | 18443.60 Pln | |
| BLDpharm | 100mg | 1308.45 Pln | |
| BLDpharm | 250mg | 1602.79 Pln | |
| BLDpharm | 1g | 1913.80 Pln | |
| BLDpharm | 5g | 6140.08 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-(2-propan-2-ylphenyl)pyrrolidine (CAS 1212895-72-1) is a chemical compound with the molecular formula C13H19N and a molecular weight of 189.30 g/mol. IUPAC name: (2S)-2-(2-propan-2-ylphenyl)pyrrolidine. InChIKey: BOHFZXYLEIZSCX-ZDUSSCGKSA-N.
| Molecular formula | C13H19N |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | (2S)-2-(2-propan-2-ylphenyl)pyrrolidine |
| InChIKey | BOHFZXYLEIZSCX-ZDUSSCGKSA-N |
| SMILES | CC(C)C1=CC=CC=C1[C@@H]2CCCN2 |
Computed by PubChem (NCBI)
![(2S)-2-[2-(Propan-2-yl)phenyl]pyrrolidine, 95%](https://cdn.chemat.com.pl/products/images/2e911ab26d27fc1cee4e85939962ea3820f8657c6168d1575f272b476507be51.svg)