cas: 102849-49-0 — see every product listed under this CAS number, including other names
(S)-2-(2-Oxopyrrolidin-1-yl)butanoic acid 97% (CAS 102849-49-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A236920-100mg |
| cas | 102849-49-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 453.81 Pln | |
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1805.50 Pln | |
| Ambeed | 5g | 7729.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A236920 |
Levetiracetam acid is an organonitrogen compound and an organooxygen compound. It is functionally related to an alpha-amino acid.
Source: ChEBI
| Molecular formula | C8H13NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | (2S)-2-(2-oxopyrrolidin-1-yl)butanoic acid |
| InChIKey | IODGAONBTQRGGG-LURJTMIESA-N |
| SMILES | CC[C@@H](C(=O)O)N1CCCC1=O |
Computed by PubChem (NCBI)