cas: 1213334-10-1 — see every product listed under this CAS number, including other names
(S)-2-(3,5-DIMETHYLPHENYL)PYRROLIDINE, 95%, 95% (CAS 1213334-10-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118QI2-100mg |
| cas | 1213334-10-1 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 899.60 Pln | |
| Chemat | 5g | 2997.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(3,5-dimethylphenyl)pyrrolidine (CAS 1213334-10-1) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: (2S)-2-(3,5-dimethylphenyl)pyrrolidine. InChIKey: SHGUHZCFMGGKFO-LBPRGKRZSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | (2S)-2-(3,5-dimethylphenyl)pyrrolidine |
| InChIKey | SHGUHZCFMGGKFO-LBPRGKRZSA-N |
| SMILES | CC1=CC(=CC(=C1)[C@@H]2CCCN2)C |
Computed by PubChem (NCBI)